Home > News > The chemical reactions of iron oxide Fe2O3

The chemical reactions of iron oxide Fe2O3

wallpapers News 2021-08-02
Iron oxidizes in the air to produce iron oxide Fe2O3, the chemical equation is 4Fe+3O2=2Fe2O3; iron oxidizes in pure oxygen to produce ferroferric oxide, the chemical equation is 3Fe+2O2=ignition=Fe3O4. Iron is a representative of the iron group element and the most commonly used metal. It is a kind of transition metal and the second-highest metal element in the earth's crust.
The chemical formula for reaction with dilute sulfuric acid:
Fe2O3+3H2SO4==Fe2(SO4)3+3H2O
The chemical formula that reacts with carbon monoxide:
3CO+Fe2O3=high temperature=2Fe+3CO2
React with enough dilute nitric acid:
Fe2O3+6HNO3===2Fe(NO3)3+3H2O
Chemical formula for reaction with dilute hydrochloric acid:
Fe2O3+6HCl==2FeCl3+3H2O
Iron element properties
Iron is active and a strong reducing agent. Its valences are 0, +2, +3, and +6. The most common valence states are +2 and +3. At room temperature, iron cannot replace hydrogen from water, and the reaction rate increases above 500°C. Its compounds and their aqueous solutions are often colored.
Iron is difficult to react with oxygen in dry air, but it is prone to electrochemical corrosion in moist air. If it is corroded in acid gas or in saltwater or halogen vapor atmosphere, it will corrode faster. Iron can reduce gold, platinum, silver, mercury, copper or tin ions from the solution.
The brief introduction of oxidation reaction
The effect of a substance losing electrons is called oxidation; on the contrary, the effect of gaining electrons is called reduction. In a narrow sense, oxidation reaction refers to the combination of substances and oxidation; reduction reaction refers to the effect of substances losing oxygen. The oxidation value increases during oxidation; the oxidation value decreases during reduction. Both oxidation and reduction refer to reactants (molecules, ions or atoms).
Oxidation is also called an oxidation reaction. The action of introducing organic matter into oxygen or removing hydrogen during the reaction of organic matter is called oxidation; the action of introducing hydrogen or losing oxygen is called reduction. The oxidation that reacts slowly with oxygen and generates heat without luminescence is called slow oxidation, such as metal corrosion and biological respiration, and the oxidation that violently emits heat is called combustion.


Say something
  • All comments(0)
    No comment yet. Please say something!
Tag: